C25H37NO2 — CID 164913381
2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]-3-methylbutanoic acid (PubChem CID 164913381) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 164913381 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]-3-methylbutanoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=N/C(C(=O)O)C(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H37NO2/c1-18(2)23(24(27)28)26-17-15-20(4)11-8-10-19(3)13-14-22-21(5)12-9-16-25(22,6)7/h8,10-11,13-15,17-18,23H,9,12,16H2,1-7H3,(H,27,28)/b11-8+,14-13+,19-10+,20-15+,26-17+ |
| InChIKey | XMJMDCHRSVYFJV-SRMSEUIGSA-N |
| XLogP | 6.70 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|