C23H35NO3 — CID 11164686
1-[(E)-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]propane-1,2,3-triol (PubChem CID 11164686) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is 1-[(E)-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]propane-1,2,3-triol.
| Compound Name | 1-[(E)-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]propane-1,2,3-triol |
|---|---|
| PubChem CID | 11164686 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 1-[(E)-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]amino]propane-1,2,3-triol |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=N/C(O)C(O)CO)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H35NO3/c1-17(11-12-20-19(3)10-7-14-23(20,4)5)8-6-9-18(2)13-15-24-22(27)21(26)16-25/h6,8-9,11-13,15,21-22,25-27H,7,10,14,16H2,1-5H3/b9-6+,12-11+,17-8+,18-13+,24-15+ |
| InChIKey | WKXMNTAPDSTRBW-XIJXDWDOSA-N |
| XLogP | 4.26 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|