C21H31NO2 — CID 143027333
2-[[(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-ylidene]amino]propanoic acid (PubChem CID 143027333) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 2-[[(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-ylidene]amino]propanoic acid.
| Compound Name | 2-[[(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-ylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 143027333 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 2-[[(3E,5E,7E)-6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5,7-trien-2-ylidene]amino]propanoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=N/C(C)C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H31NO2/c1-15(9-7-11-17(3)22-18(4)20(23)24)12-13-19-16(2)10-8-14-21(19,5)6/h7,9,11-13,18H,8,10,14H2,1-6H3,(H,23,24)/b11-7+,13-12+,15-9+,22-17+ |
| InChIKey | DGIMKMJUNBPYAP-FWSYVWDGSA-N |
| XLogP | 5.51 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|