C22H33N3O4 — CID 15383623
3-methylbut-2-enyl (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoate (PubChem CID 15383623) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 3-methylbut-2-enyl (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoate.
| Compound Name | 3-methylbut-2-enyl (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 15383623 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 3-methylbut-2-enyl (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylbutanoyl]amino]-3-phenylpropanoate |
| SMILES | CC(C)=CCOC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@H](C)N)C(C)C |
| InChI | InChI=1S/C22H33N3O4/c1-14(2)11-12-29-22(28)18(13-17-9-7-6-8-10-17)24-21(27)19(15(3)4)25-20(26)16(5)23/h6-11,15-16,18-19H,12-13,23H2,1-5H3,(H,24,27)(H,25,26)/t16-,18-,19-/m0/s1 |
| InChIKey | HFRQXTHKKJRNOH-WDSOQIARSA-N |
| XLogP | 1.71 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|