C17H30N2O3 — CID 143387346
[(2E,4E)-3-methylhexa-2,4-dienyl] 2-[[(2S)-2-aminopropanoyl]amino]propanoate;2-methylprop-1-ene (PubChem CID 143387346) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is [(2E,4E)-3-methylhexa-2,4-dienyl] 2-[[(2S)-2-aminopropanoyl]amino]propanoate;2-methylprop-1-ene.
| Compound Name | [(2E,4E)-3-methylhexa-2,4-dienyl] 2-[[(2S)-2-aminopropanoyl]amino]propanoate;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143387346 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | [(2E,4E)-3-methylhexa-2,4-dienyl] 2-[[(2S)-2-aminopropanoyl]amino]propanoate;2-methylprop-1-ene |
| SMILES | C/C=C/C(C)=C/COC(=O)C(C)NC(=O)[C@H](C)N.C=C(C)C |
| InChI | InChI=1S/C13H22N2O3.C4H8/c1-5-6-9(2)7-8-18-13(17)11(4)15-12(16)10(3)14;1-4(2)3/h5-7,10-11H,8,14H2,1-4H3,(H,15,16);1H2,2-3H3/b6-5+,9-7+;/t10-,11?;/m0./s1 |
| InChIKey | BLTAFKZGPBJAMF-SFUSZFEUSA-N |
| XLogP | 2.49 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|