About 5-methylhex-3-en-2-one;palladium(2+);dichloride
5-methylhex-3-en-2-one;palladium(2+);dichloride (PubChem CID 173341273) has the molecular formula C7H12Cl2OPd
and a molecular weight of 289.50 g/mol. Its IUPAC name is 5-methylhex-3-en-2-one;palladium(2+);dichloride.
Molecular Properties
| Compound Name | 5-methylhex-3-en-2-one;palladium(2+);dichloride |
| PubChem CID | 173341273 |
| Molecular Formula | C7H12Cl2OPd |
| Molecular Weight | 289.50 g/mol |
| Exact Mass | 287.93 |
| IUPAC Name | 5-methylhex-3-en-2-one;palladium(2+);dichloride |
| SMILES | CC(=O)C=CC(C)C.[Cl-].[Cl-].[Pd+2] |
| InChI | InChI=1S/C7H12O.2ClH.Pd/c1-6(2)4-5-7(3)8;;;/h4-6H,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | ASEJXRHRLMKQKS-UHFFFAOYSA-L |
| XLogP | -4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.50 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhex-3-en-2-one;palladium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhex-3-en-2-one;palladium(2+);dichloride?
The IUPAC name of 5-methylhex-3-en-2-one;palladium(2+);dichloride (CID 173341273) is 5-methylhex-3-en-2-one;palladium(2+);dichloride.
What is the SMILES notation for 5-methylhex-3-en-2-one;palladium(2+);dichloride?
The canonical SMILES for 5-methylhex-3-en-2-one;palladium(2+);dichloride is CC(=O)C=CC(C)C.[Cl-].[Cl-].[Pd+2].
What is the InChIKey of 5-methylhex-3-en-2-one;palladium(2+);dichloride?
The InChIKey is ASEJXRHRLMKQKS-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H12O.2ClH.Pd/c1-6(2)4-5-7(3)8;;;/h4-6H,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of 5-methylhex-3-en-2-one;palladium(2+);dichloride?
5-methylhex-3-en-2-one;palladium(2+);dichloride has a molecular weight of 289.50 g/mol, XLogP of -4.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhex-3-en-2-one;palladium(2+);dichloride is sourced from PubChem (CID 173341273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).