C8H12O2 — CID 171377981
(1E,4E)-1-hydroxy-6-methylhepta-1,4-dien-3-one (PubChem CID 171377981) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (1E,4E)-1-hydroxy-6-methylhepta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-hydroxy-6-methylhepta-1,4-dien-3-one |
|---|---|
| PubChem CID | 171377981 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (1E,4E)-1-hydroxy-6-methylhepta-1,4-dien-3-one |
| SMILES | CC(C)/C=C/C(=O)/C=C/O |
| InChI | InChI=1S/C8H12O2/c1-7(2)3-4-8(10)5-6-9/h3-7,9H,1-2H3/b4-3+,6-5+ |
| InChIKey | VHNODVLGZMZDNN-VNKDHWASSA-N |
| XLogP | 1.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|