C16H30O2 — CID 161014897
(E)-2,6-dimethylhept-4-en-3-one;2,4-dimethylpentan-3-one (PubChem CID 161014897) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (E)-2,6-dimethylhept-4-en-3-one;2,4-dimethylpentan-3-one.
| Compound Name | (E)-2,6-dimethylhept-4-en-3-one;2,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 161014897 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (E)-2,6-dimethylhept-4-en-3-one;2,4-dimethylpentan-3-one |
| SMILES | CC(C)/C=C/C(=O)C(C)C.CC(C)C(=O)C(C)C |
| InChI | InChI=1S/C9H16O.C7H14O/c1-7(2)5-6-9(10)8(3)4;1-5(2)7(8)6(3)4/h5-8H,1-4H3;5-6H,1-4H3/b6-5+; |
| InChIKey | TXPDTMJGJBWZSP-IPZCTEOASA-N |
| XLogP | 4.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|