C11H20N2O — CID 138496323
[(3E,5Z)-2,7-dimethylocta-3,5-dien-4-yl]urea (PubChem CID 138496323) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is [(3E,5Z)-2,7-dimethylocta-3,5-dien-4-yl]urea.
| Compound Name | [(3E,5Z)-2,7-dimethylocta-3,5-dien-4-yl]urea |
|---|---|
| PubChem CID | 138496323 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | [(3E,5Z)-2,7-dimethylocta-3,5-dien-4-yl]urea |
| SMILES | CC(C)/C=C\C(=C/C(C)C)NC(N)=O |
| InChI | InChI=1S/C11H20N2O/c1-8(2)5-6-10(7-9(3)4)13-11(12)14/h5-9H,1-4H3,(H3,12,13,14)/b6-5-,10-7+ |
| InChIKey | LWYNHQGGXSYUAY-ZZWPSLBBSA-N |
| XLogP | 2.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|