C10H16O — CID 91250506
(E,3E)-3-ethylidene-6-methylhept-4-en-2-one (PubChem CID 91250506) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (E,3E)-3-ethylidene-6-methylhept-4-en-2-one.
| Compound Name | (E,3E)-3-ethylidene-6-methylhept-4-en-2-one |
|---|---|
| PubChem CID | 91250506 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (E,3E)-3-ethylidene-6-methylhept-4-en-2-one |
| SMILES | C/C=C(\C=C\C(C)C)C(C)=O |
| InChI | InChI=1S/C10H16O/c1-5-10(9(4)11)7-6-8(2)3/h5-8H,1-4H3/b7-6+,10-5+ |
| InChIKey | XHFRDVIDJOATIZ-XYLIHAQWSA-N |
| XLogP | 2.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|