C19H28O2 — CID 143376285
[(2Z,4E)-7-methylocta-2,4,6-trien-4-yl] (Z,2E)-5-methyl-2-propylidenehex-3-enoate (PubChem CID 143376285) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is [(2Z,4E)-7-methylocta-2,4,6-trien-4-yl] (Z,2E)-5-methyl-2-propylidenehex-3-enoate.
| Compound Name | [(2Z,4E)-7-methylocta-2,4,6-trien-4-yl] (Z,2E)-5-methyl-2-propylidenehex-3-enoate |
|---|---|
| PubChem CID | 143376285 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | [(2Z,4E)-7-methylocta-2,4,6-trien-4-yl] (Z,2E)-5-methyl-2-propylidenehex-3-enoate |
| SMILES | C/C=C\C(=C/C=C(C)C)OC(=O)C(/C=C\C(C)C)=C/CC |
| InChI | InChI=1S/C19H28O2/c1-7-9-17(13-11-15(3)4)19(20)21-18(10-8-2)14-12-16(5)6/h8-15H,7H2,1-6H3/b10-8-,13-11-,17-9+,18-14+ |
| InChIKey | ZQCJKSZBMCEPCZ-TWVZBAGSSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|