C12H15F3O2 — CID 143087164
(Z,5E)-5-ethylidene-1,1,1-trifluoro-8-methylnon-6-ene-2,4-dione (PubChem CID 143087164) has the molecular formula C12H15F3O2 and a molecular weight of 248.24 g/mol. Its IUPAC name is (Z,5E)-5-ethylidene-1,1,1-trifluoro-8-methylnon-6-ene-2,4-dione.
| Compound Name | (Z,5E)-5-ethylidene-1,1,1-trifluoro-8-methylnon-6-ene-2,4-dione |
|---|---|
| PubChem CID | 143087164 |
| Molecular Formula | C12H15F3O2 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (Z,5E)-5-ethylidene-1,1,1-trifluoro-8-methylnon-6-ene-2,4-dione |
| SMILES | C/C=C(\C=C/C(C)C)C(=O)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F3O2/c1-4-9(6-5-8(2)3)10(16)7-11(17)12(13,14)15/h4-6,8H,7H2,1-3H3/b6-5-,9-4+ |
| InChIKey | KHWZWBCMOAWKRI-CXBDEZGUSA-N |
| XLogP | 3.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|