C11H18O2 — CID 143046448
(Z,3E)-6-ethoxy-3-ethylidenehept-4-en-2-one (PubChem CID 143046448) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (Z,3E)-6-ethoxy-3-ethylidenehept-4-en-2-one.
| Compound Name | (Z,3E)-6-ethoxy-3-ethylidenehept-4-en-2-one |
|---|---|
| PubChem CID | 143046448 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (Z,3E)-6-ethoxy-3-ethylidenehept-4-en-2-one |
| SMILES | C/C=C(\C=C/C(C)OCC)C(C)=O |
| InChI | InChI=1S/C11H18O2/c1-5-11(10(4)12)8-7-9(3)13-6-2/h5,7-9H,6H2,1-4H3/b8-7-,11-5+ |
| InChIKey | DSSYREWMUPFVPR-LTCQKBRTSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|