C14H24O3 — CID 10900753
(5E)-8,8-diethoxy-2,7-dimethylocta-2,5-dien-4-one (PubChem CID 10900753) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (5E)-8,8-diethoxy-2,7-dimethylocta-2,5-dien-4-one.
| Compound Name | (5E)-8,8-diethoxy-2,7-dimethylocta-2,5-dien-4-one |
|---|---|
| PubChem CID | 10900753 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (5E)-8,8-diethoxy-2,7-dimethylocta-2,5-dien-4-one |
| SMILES | CCOC(OCC)C(C)/C=C/C(=O)C=C(C)C |
| InChI | InChI=1S/C14H24O3/c1-6-16-14(17-7-2)12(5)8-9-13(15)10-11(3)4/h8-10,12,14H,6-7H2,1-5H3/b9-8+ |
| InChIKey | LSHHKFNSFOJQMW-CMDGGOBGSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|