About 2-ethoxypropanoic acid;methane
2-ethoxypropanoic acid;methane (PubChem CID 160636954) has the molecular formula C7H18O3
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-ethoxypropanoic acid;methane.
Molecular Properties
| Compound Name | 2-ethoxypropanoic acid;methane |
| PubChem CID | 160636954 |
| Molecular Formula | C7H18O3 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.13 |
| IUPAC Name | 2-ethoxypropanoic acid;methane |
| SMILES | C.C.CCOC(C)C(=O)O |
| InChI | InChI=1S/C5H10O3.2CH4/c1-3-8-4(2)5(6)7;;/h4H,3H2,1-2H3,(H,6,7);2*1H4 |
| InChIKey | RIQUWOMJQYHVCR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxypropanoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxypropanoic acid;methane?
The IUPAC name of 2-ethoxypropanoic acid;methane (CID 160636954) is 2-ethoxypropanoic acid;methane.
What is the SMILES notation for 2-ethoxypropanoic acid;methane?
The canonical SMILES for 2-ethoxypropanoic acid;methane is C.C.CCOC(C)C(=O)O.
What is the InChIKey of 2-ethoxypropanoic acid;methane?
The InChIKey is RIQUWOMJQYHVCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.2CH4/c1-3-8-4(2)5(6)7;;/h4H,3H2,1-2H3,(H,6,7);2*1H4.
What are the key properties of 2-ethoxypropanoic acid;methane?
2-ethoxypropanoic acid;methane has a molecular weight of 150.22 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxypropanoic acid;methane is sourced from PubChem (CID 160636954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).