(2R)-2-(aminomethoxy)propanoic acid

C4H9NO3 — CID 147031217

IUPAC(2R)-2-(aminomethoxy)propanoic acid
SMILESC[C@@H](OCN)C(=O)O
InChIInChI=1S/C4H9NO3/c1-3(4(6)7)8-2-5/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1
InChIKeyAXQHYKQGHDFIRP-GSVOUGTGSA-N
MW119.12 g/mol
LogP-0.61
Rot. Bonds3

About (2R)-2-(aminomethoxy)propanoic acid

(2R)-2-(aminomethoxy)propanoic acid (PubChem CID 147031217) has the molecular formula C4H9NO3 and a molecular weight of 119.12 g/mol. Its IUPAC name is (2R)-2-(aminomethoxy)propanoic acid.

Molecular Properties

Compound Name(2R)-2-(aminomethoxy)propanoic acid
PubChem CID147031217
Molecular FormulaC4H9NO3
Molecular Weight119.12 g/mol
Exact Mass119.06
IUPAC Name(2R)-2-(aminomethoxy)propanoic acid
SMILESC[C@@H](OCN)C(=O)O
InChIInChI=1S/C4H9NO3/c1-3(4(6)7)8-2-5/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1
InChIKeyAXQHYKQGHDFIRP-GSVOUGTGSA-N
XLogP-0.61
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500119.12
LogP ≤ 5-0.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze (2R)-2-(aminomethoxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(2-amino-2-oxoethoxy)propanoic acid
CID 88812452
2-(2-fluoroethoxy)propanoic acid
CID 84648269
2-ethoxypropanoic acid;methane
CID 160636954
2-(2-aminooxyethoxy)propanoic acid
CID 175557781
(2R)-2-(methoxymethoxy)propanoic acid
CID 10844423
ethane-1,2-diol;2-ethoxypropanoic acid
CID 87566881
(2S)-2-(2-ethylbutoxy)propanoic acid
CID 104876124
(2S)-2-[(2S)-2-methylbutoxy]propanoic acid
CID 150908774
2-[[2-(aminomethyl)cyclopentyl]methoxy]propanoic acid
CID 106940301
(2S)-2-(2-methylsulfanylethoxy)propanoic acid
CID 104875904
2-but-3-enoxypropanoic acid
CID 43128770
(2S)-2-[2-[di(propan-2-yl)amino]-2-oxoethoxy]propanoic acid
CID 104876420

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(aminomethoxy)propanoic acid?
The IUPAC name of (2R)-2-(aminomethoxy)propanoic acid (CID 147031217) is (2R)-2-(aminomethoxy)propanoic acid.
What is the SMILES notation for (2R)-2-(aminomethoxy)propanoic acid?
The canonical SMILES for (2R)-2-(aminomethoxy)propanoic acid is C[C@@H](OCN)C(=O)O.
What is the InChIKey of (2R)-2-(aminomethoxy)propanoic acid?
The InChIKey is AXQHYKQGHDFIRP-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H9NO3/c1-3(4(6)7)8-2-5/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1.
What are the key properties of (2R)-2-(aminomethoxy)propanoic acid?
(2R)-2-(aminomethoxy)propanoic acid has a molecular weight of 119.12 g/mol, XLogP of -0.61, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(aminomethoxy)propanoic acid is sourced from PubChem (CID 147031217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).