ethane-1,2-diol;2-ethoxypropanoic acid

C7H16O5 — CID 87566881

IUPACethane-1,2-diol;2-ethoxypropanoic acid
SMILESCCOC(C)C(=O)O.OCCO
InChIInChI=1S/C5H10O3.C2H6O2/c1-3-8-4(2)5(6)7;3-1-2-4/h4H,3H2,1-2H3,(H,6,7);3-4H,1-2H2
InChIKeyRFDNCBIESRVGJM-UHFFFAOYSA-N
MW180.20 g/mol
LogP-0.53
Rot. Bonds4

About ethane-1,2-diol;2-ethoxypropanoic acid

ethane-1,2-diol;2-ethoxypropanoic acid (PubChem CID 87566881) has the molecular formula C7H16O5 and a molecular weight of 180.20 g/mol. Its IUPAC name is ethane-1,2-diol;2-ethoxypropanoic acid.

Molecular Properties

Compound Nameethane-1,2-diol;2-ethoxypropanoic acid
PubChem CID87566881
Molecular FormulaC7H16O5
Molecular Weight180.20 g/mol
Exact Mass180.10
IUPAC Nameethane-1,2-diol;2-ethoxypropanoic acid
SMILESCCOC(C)C(=O)O.OCCO
InChIInChI=1S/C5H10O3.C2H6O2/c1-3-8-4(2)5(6)7;3-1-2-4/h4H,3H2,1-2H3,(H,6,7);3-4H,1-2H2
InChIKeyRFDNCBIESRVGJM-UHFFFAOYSA-N
XLogP-0.53
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.20
LogP ≤ 5-0.53
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze ethane-1,2-diol;2-ethoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane-1,2-diol;2-ethoxypropanoic acid?
The IUPAC name of ethane-1,2-diol;2-ethoxypropanoic acid (CID 87566881) is ethane-1,2-diol;2-ethoxypropanoic acid.
What is the SMILES notation for ethane-1,2-diol;2-ethoxypropanoic acid?
The canonical SMILES for ethane-1,2-diol;2-ethoxypropanoic acid is CCOC(C)C(=O)O.OCCO.
What is the InChIKey of ethane-1,2-diol;2-ethoxypropanoic acid?
The InChIKey is RFDNCBIESRVGJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C2H6O2/c1-3-8-4(2)5(6)7;3-1-2-4/h4H,3H2,1-2H3,(H,6,7);3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;2-ethoxypropanoic acid?
ethane-1,2-diol;2-ethoxypropanoic acid has a molecular weight of 180.20 g/mol, XLogP of -0.53, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;2-ethoxypropanoic acid is sourced from PubChem (CID 87566881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).