sodium 2-ethoxypropanoate

C5H9NaO3 — CID 141029681

IUPACsodium 2-ethoxypropanoate
SMILESCCOC(C)C(=O)[O-].[Na+]
InChIInChI=1S/C5H10O3.Na/c1-3-8-4(2)5(6)7;/h4H,3H2,1-2H3,(H,6,7);/q;+1/p-1
InChIKeyWDWFJNDFXUNFCP-UHFFFAOYSA-M
MW140.11 g/mol
LogP-3.83
Rot. Bonds3

About sodium 2-ethoxypropanoate

sodium 2-ethoxypropanoate (PubChem CID 141029681) has the molecular formula C5H9NaO3 and a molecular weight of 140.11 g/mol. Its IUPAC name is sodium 2-ethoxypropanoate.

Molecular Properties

Compound Namesodium 2-ethoxypropanoate
PubChem CID141029681
Molecular FormulaC5H9NaO3
Molecular Weight140.11 g/mol
Exact Mass140.04
IUPAC Namesodium 2-ethoxypropanoate
SMILESCCOC(C)C(=O)[O-].[Na+]
InChIInChI=1S/C5H10O3.Na/c1-3-8-4(2)5(6)7;/h4H,3H2,1-2H3,(H,6,7);/q;+1/p-1
InChIKeyWDWFJNDFXUNFCP-UHFFFAOYSA-M
XLogP-3.83
TPSA49.36 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.11
LogP ≤ 5-3.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze sodium 2-ethoxypropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-ethoxypropanoate?
The IUPAC name of sodium 2-ethoxypropanoate (CID 141029681) is sodium 2-ethoxypropanoate.
What is the SMILES notation for sodium 2-ethoxypropanoate?
The canonical SMILES for sodium 2-ethoxypropanoate is CCOC(C)C(=O)[O-].[Na+].
What is the InChIKey of sodium 2-ethoxypropanoate?
The InChIKey is WDWFJNDFXUNFCP-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O3.Na/c1-3-8-4(2)5(6)7;/h4H,3H2,1-2H3,(H,6,7);/q;+1/p-1.
What are the key properties of sodium 2-ethoxypropanoate?
sodium 2-ethoxypropanoate has a molecular weight of 140.11 g/mol, XLogP of -3.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-ethoxypropanoate is sourced from PubChem (CID 141029681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).