C6H11KO4 — CID 87278402
potassium 2,2-diethoxyacetate (PubChem CID 87278402) has the molecular formula C6H11KO4 and a molecular weight of 186.25 g/mol. Its IUPAC name is potassium 2,2-diethoxyacetate.
| Compound Name | potassium 2,2-diethoxyacetate |
|---|---|
| PubChem CID | 87278402 |
| Molecular Formula | C6H11KO4 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | potassium 2,2-diethoxyacetate |
| SMILES | CCOC(OCC)C(=O)[O-].[K+] |
| InChI | InChI=1S/C6H12O4.K/c1-3-9-6(5(7)8)10-4-2;/h6H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1 |
| InChIKey | PNRIGHQYXRDOTB-UHFFFAOYSA-M |
| XLogP | -3.86 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|