About 3-chloro-1,1-diethoxypropan-2-one
3-chloro-1,1-diethoxypropan-2-one (PubChem CID 10921139) has the molecular formula C7H13ClO3
and a molecular weight of 180.63 g/mol. Its IUPAC name is 3-chloro-1,1-diethoxypropan-2-one.
Molecular Properties
| Compound Name | 3-chloro-1,1-diethoxypropan-2-one |
| PubChem CID | 10921139 |
| Molecular Formula | C7H13ClO3 |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 3-chloro-1,1-diethoxypropan-2-one |
| SMILES | CCOC(OCC)C(=O)CCl |
| InChI | InChI=1S/C7H13ClO3/c1-3-10-7(11-4-2)6(9)5-8/h7H,3-5H2,1-2H3 |
| InChIKey | ZHLVNNGLCOHLAU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1,1-diethoxypropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1,1-diethoxypropan-2-one?
The IUPAC name of 3-chloro-1,1-diethoxypropan-2-one (CID 10921139) is 3-chloro-1,1-diethoxypropan-2-one.
What is the SMILES notation for 3-chloro-1,1-diethoxypropan-2-one?
The canonical SMILES for 3-chloro-1,1-diethoxypropan-2-one is CCOC(OCC)C(=O)CCl.
What is the InChIKey of 3-chloro-1,1-diethoxypropan-2-one?
The InChIKey is ZHLVNNGLCOHLAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO3/c1-3-10-7(11-4-2)6(9)5-8/h7H,3-5H2,1-2H3.
What are the key properties of 3-chloro-1,1-diethoxypropan-2-one?
3-chloro-1,1-diethoxypropan-2-one has a molecular weight of 180.63 g/mol, XLogP of 1.19, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1,1-diethoxypropan-2-one is sourced from PubChem (CID 10921139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).