C7H13ClO3 — CID 86719470
3,3-diethoxypropanoyl chloride (PubChem CID 86719470) has the molecular formula C7H13ClO3 and a molecular weight of 180.63 g/mol. Its IUPAC name is 3,3-diethoxypropanoyl chloride.
| Compound Name | 3,3-diethoxypropanoyl chloride |
|---|---|
| PubChem CID | 86719470 |
| Molecular Formula | C7H13ClO3 |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 3,3-diethoxypropanoyl chloride |
| SMILES | CCOC(CC(=O)Cl)OCC |
| InChI | InChI=1S/C7H13ClO3/c1-3-10-7(11-4-2)5-6(8)9/h7H,3-5H2,1-2H3 |
| InChIKey | KRSSEJHHDWDOAM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|