C17H28O3 — CID 115480615
1-(1-adamantyl)-3,3-diethoxypropan-1-one (PubChem CID 115480615) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-(1-adamantyl)-3,3-diethoxypropan-1-one.
| Compound Name | 1-(1-adamantyl)-3,3-diethoxypropan-1-one |
|---|---|
| PubChem CID | 115480615 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-(1-adamantyl)-3,3-diethoxypropan-1-one |
| SMILES | CCOC(CC(=O)C12CC3CC(CC(C3)C1)C2)OCC |
| InChI | InChI=1S/C17H28O3/c1-3-19-16(20-4-2)8-15(18)17-9-12-5-13(10-17)7-14(6-12)11-17/h12-14,16H,3-11H2,1-2H3 |
| InChIKey | FLQDYLUODSUJKY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|