C8H13Cl3O3 — CID 131860335
1,1,1-trichloro-4,4-diethoxybutan-2-one (PubChem CID 131860335) has the molecular formula C8H13Cl3O3 and a molecular weight of 263.55 g/mol. Its IUPAC name is 1,1,1-trichloro-4,4-diethoxybutan-2-one.
| Compound Name | 1,1,1-trichloro-4,4-diethoxybutan-2-one |
|---|---|
| PubChem CID | 131860335 |
| Molecular Formula | C8H13Cl3O3 |
| Molecular Weight | 263.55 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 1,1,1-trichloro-4,4-diethoxybutan-2-one |
| SMILES | CCOC(CC(=O)C(Cl)(Cl)Cl)OCC |
| InChI | InChI=1S/C8H13Cl3O3/c1-3-13-7(14-4-2)5-6(12)8(9,10)11/h7H,3-5H2,1-2H3 |
| InChIKey | BQULNCMSBPMXRF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|