C6H7Cl5O2 — CID 12033907
1,1,1,3,4-pentachloro-4-ethoxybutan-2-one (PubChem CID 12033907) has the molecular formula C6H7Cl5O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1,1,1,3,4-pentachloro-4-ethoxybutan-2-one.
| Compound Name | 1,1,1,3,4-pentachloro-4-ethoxybutan-2-one |
|---|---|
| PubChem CID | 12033907 |
| Molecular Formula | C6H7Cl5O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 285.89 |
| IUPAC Name | 1,1,1,3,4-pentachloro-4-ethoxybutan-2-one |
| SMILES | CCOC(Cl)C(Cl)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H7Cl5O2/c1-2-13-5(8)3(7)4(12)6(9,10)11/h3,5H,2H2,1H3 |
| InChIKey | KUSKGXGSCLVDSP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|