About 2-ethoxybutanoate
2-ethoxybutanoate (PubChem CID 21321797) has the molecular formula C6H11O3-
and a molecular weight of 131.15 g/mol. Its IUPAC name is 2-ethoxybutanoate.
Molecular Properties
| Compound Name | 2-ethoxybutanoate |
| PubChem CID | 21321797 |
| Molecular Formula | C6H11O3- |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 2-ethoxybutanoate |
| SMILES | CCOC(CC)C(=O)[O-] |
| InChI | InChI=1S/C6H12O3/c1-3-5(6(7)8)9-4-2/h5H,3-4H2,1-2H3,(H,7,8)/p-1 |
| InChIKey | JEPGPKGGSYXGKV-UHFFFAOYSA-M |
| XLogP | -0.45 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybutanoate?
The IUPAC name of 2-ethoxybutanoate (CID 21321797) is 2-ethoxybutanoate.
What is the SMILES notation for 2-ethoxybutanoate?
The canonical SMILES for 2-ethoxybutanoate is CCOC(CC)C(=O)[O-].
What is the InChIKey of 2-ethoxybutanoate?
The InChIKey is JEPGPKGGSYXGKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O3/c1-3-5(6(7)8)9-4-2/h5H,3-4H2,1-2H3,(H,7,8)/p-1.
What are the key properties of 2-ethoxybutanoate?
2-ethoxybutanoate has a molecular weight of 131.15 g/mol, XLogP of -0.45, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybutanoate is sourced from PubChem (CID 21321797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).