About diazanium;2-butyl-5-ethoxyhexanedioate
diazanium;2-butyl-5-ethoxyhexanedioate (PubChem CID 156787256) has the molecular formula C12H28N2O5
and a molecular weight of 280.37 g/mol. Its IUPAC name is diazanium;2-butyl-5-ethoxyhexanedioate.
Molecular Properties
| Compound Name | diazanium;2-butyl-5-ethoxyhexanedioate |
| PubChem CID | 156787256 |
| Molecular Formula | C12H28N2O5 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | diazanium;2-butyl-5-ethoxyhexanedioate |
| SMILES | CCCCC(CCC(OCC)C(=O)[O-])C(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C12H22O5.2H3N/c1-3-5-6-9(11(13)14)7-8-10(12(15)16)17-4-2;;/h9-10H,3-8H2,1-2H3,(H,13,14)(H,15,16);2*1H3 |
| InChIKey | YOZVENRWUUKFLL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 162.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diazanium;2-butyl-5-ethoxyhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;2-butyl-5-ethoxyhexanedioate?
The IUPAC name of diazanium;2-butyl-5-ethoxyhexanedioate (CID 156787256) is diazanium;2-butyl-5-ethoxyhexanedioate.
What is the SMILES notation for diazanium;2-butyl-5-ethoxyhexanedioate?
The canonical SMILES for diazanium;2-butyl-5-ethoxyhexanedioate is CCCCC(CCC(OCC)C(=O)[O-])C(=O)[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;2-butyl-5-ethoxyhexanedioate?
The InChIKey is YOZVENRWUUKFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O5.2H3N/c1-3-5-6-9(11(13)14)7-8-10(12(15)16)17-4-2;;/h9-10H,3-8H2,1-2H3,(H,13,14)(H,15,16);2*1H3.
What are the key properties of diazanium;2-butyl-5-ethoxyhexanedioate?
diazanium;2-butyl-5-ethoxyhexanedioate has a molecular weight of 280.37 g/mol, XLogP of 0.23, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;2-butyl-5-ethoxyhexanedioate is sourced from PubChem (CID 156787256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).