(2R)-2-ethoxybutanedioic acid

C6H10O5 — CID 101245963

IUPAC(2R)-2-ethoxybutanedioic acid
SMILESCCO[C@H](CC(=O)O)C(=O)O
InChIInChI=1S/C6H10O5/c1-2-11-4(6(9)10)3-5(7)8/h4H,2-3H2,1H3,(H,7,8)(H,9,10)/t4-/m1/s1
InChIKeyGDXKLPSQGLQURU-SCSAIBSYSA-N
MW162.14 g/mol
LogP-0.05
Rot. Bonds5

About (2R)-2-ethoxybutanedioic acid

(2R)-2-ethoxybutanedioic acid (PubChem CID 101245963) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. Its IUPAC name is (2R)-2-ethoxybutanedioic acid.

Molecular Properties

Compound Name(2R)-2-ethoxybutanedioic acid
PubChem CID101245963
Molecular FormulaC6H10O5
Molecular Weight162.14 g/mol
Exact Mass162.05
IUPAC Name(2R)-2-ethoxybutanedioic acid
SMILESCCO[C@H](CC(=O)O)C(=O)O
InChIInChI=1S/C6H10O5/c1-2-11-4(6(9)10)3-5(7)8/h4H,2-3H2,1H3,(H,7,8)(H,9,10)/t4-/m1/s1
InChIKeyGDXKLPSQGLQURU-SCSAIBSYSA-N
XLogP-0.05
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.14
LogP ≤ 5-0.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-2-ethoxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-ethoxybutanedioic acid;propane-1,2-diol
CID 87565430
2-(2,2-diethoxyethoxy)butanedioic acid
CID 150684486
2-(2-deuterioethoxy)butanedioic acid
CID 175726030
CID 159903683
CID 159903683
2-(aminomethoxy)butanedioic acid
CID 174248592
2-nonadecoxybutanedioic acid
CID 122611322
trisodium;2-(carboxymethoxy)butanedioic acid;hydride
CID 173014091
3-ethoxybutanoic acid
CID 20508399
propane-1,2-diol;2-propoxybutanedioic acid
CID 87565394
4-bromo-2-ethoxybutanoic acid
CID 174871505
2-triethoxysilyloxybutanedioic acid
CID 10957429
2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid
CID 18506229

Frequently Asked Questions

What is the IUPAC name of (2R)-2-ethoxybutanedioic acid?
The IUPAC name of (2R)-2-ethoxybutanedioic acid (CID 101245963) is (2R)-2-ethoxybutanedioic acid.
What is the SMILES notation for (2R)-2-ethoxybutanedioic acid?
The canonical SMILES for (2R)-2-ethoxybutanedioic acid is CCO[C@H](CC(=O)O)C(=O)O.
What is the InChIKey of (2R)-2-ethoxybutanedioic acid?
The InChIKey is GDXKLPSQGLQURU-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H10O5/c1-2-11-4(6(9)10)3-5(7)8/h4H,2-3H2,1H3,(H,7,8)(H,9,10)/t4-/m1/s1.
What are the key properties of (2R)-2-ethoxybutanedioic acid?
(2R)-2-ethoxybutanedioic acid has a molecular weight of 162.14 g/mol, XLogP of -0.05, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-ethoxybutanedioic acid is sourced from PubChem (CID 101245963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).