About 4-bromo-2-ethoxybutanoic acid
4-bromo-2-ethoxybutanoic acid (PubChem CID 174871505) has the molecular formula C6H11BrO3
and a molecular weight of 211.05 g/mol. Its IUPAC name is 4-bromo-2-ethoxybutanoic acid.
Molecular Properties
| Compound Name | 4-bromo-2-ethoxybutanoic acid |
| PubChem CID | 174871505 |
| Molecular Formula | C6H11BrO3 |
| Molecular Weight | 211.05 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 4-bromo-2-ethoxybutanoic acid |
| SMILES | CCOC(CCBr)C(=O)O |
| InChI | InChI=1S/C6H11BrO3/c1-2-10-5(3-4-7)6(8)9/h5H,2-4H2,1H3,(H,8,9) |
| InChIKey | MDHYSRYSMCRAJU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.05 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-ethoxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-ethoxybutanoic acid?
The IUPAC name of 4-bromo-2-ethoxybutanoic acid (CID 174871505) is 4-bromo-2-ethoxybutanoic acid.
What is the SMILES notation for 4-bromo-2-ethoxybutanoic acid?
The canonical SMILES for 4-bromo-2-ethoxybutanoic acid is CCOC(CCBr)C(=O)O.
What is the InChIKey of 4-bromo-2-ethoxybutanoic acid?
The InChIKey is MDHYSRYSMCRAJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BrO3/c1-2-10-5(3-4-7)6(8)9/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of 4-bromo-2-ethoxybutanoic acid?
4-bromo-2-ethoxybutanoic acid has a molecular weight of 211.05 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-ethoxybutanoic acid is sourced from PubChem (CID 174871505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).