About 2-ethoxy-7-oxoheptanoic acid
2-ethoxy-7-oxoheptanoic acid (PubChem CID 141127524) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 2-ethoxy-7-oxoheptanoic acid.
Molecular Properties
| Compound Name | 2-ethoxy-7-oxoheptanoic acid |
| PubChem CID | 141127524 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 2-ethoxy-7-oxoheptanoic acid |
| SMILES | CCOC(CCCCC=O)C(=O)O |
| InChI | InChI=1S/C9H16O4/c1-2-13-8(9(11)12)6-4-3-5-7-10/h7-8H,2-6H2,1H3,(H,11,12) |
| InChIKey | JJGLMWQUBNZGCV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-7-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-7-oxoheptanoic acid?
The IUPAC name of 2-ethoxy-7-oxoheptanoic acid (CID 141127524) is 2-ethoxy-7-oxoheptanoic acid.
What is the SMILES notation for 2-ethoxy-7-oxoheptanoic acid?
The canonical SMILES for 2-ethoxy-7-oxoheptanoic acid is CCOC(CCCCC=O)C(=O)O.
What is the InChIKey of 2-ethoxy-7-oxoheptanoic acid?
The InChIKey is JJGLMWQUBNZGCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-2-13-8(9(11)12)6-4-3-5-7-10/h7-8H,2-6H2,1H3,(H,11,12).
What are the key properties of 2-ethoxy-7-oxoheptanoic acid?
2-ethoxy-7-oxoheptanoic acid has a molecular weight of 188.22 g/mol, XLogP of 1.24, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-7-oxoheptanoic acid is sourced from PubChem (CID 141127524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).