About 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid
2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid (PubChem CID 18506229) has the molecular formula C13H21NO10
and a molecular weight of 351.31 g/mol. Its IUPAC name is 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid.
Molecular Properties
| Compound Name | 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid |
| PubChem CID | 18506229 |
| Molecular Formula | C13H21NO10 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid |
| SMILES | CN(CCOC(CC(=O)O)C(=O)O)CCOC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21NO10/c1-14(2-4-23-8(12(19)20)6-10(15)16)3-5-24-9(13(21)22)7-11(17)18/h8-9H,2-7H2,1H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | XBNKOFSIQLOTGK-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 170.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid?
The IUPAC name of 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid (CID 18506229) is 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid.
What is the SMILES notation for 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid?
The canonical SMILES for 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid is CN(CCOC(CC(=O)O)C(=O)O)CCOC(CC(=O)O)C(=O)O.
What is the InChIKey of 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid?
The InChIKey is XBNKOFSIQLOTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO10/c1-14(2-4-23-8(12(19)20)6-10(15)16)3-5-24-9(13(21)22)7-11(17)18/h8-9H,2-7H2,1H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22).
What are the key properties of 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid?
2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid has a molecular weight of 351.31 g/mol, XLogP of -1.19, 14 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(1,2-dicarboxyethoxy)ethyl-methylamino]ethoxy]butanedioic acid is sourced from PubChem (CID 18506229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).