C12H19NO10 — CID 59356945
2-[2-(1,2-dicarboxyethoxy)ethyl-(2-hydroxyethyl)amino]butanedioic acid (PubChem CID 59356945) has the molecular formula C12H19NO10 and a molecular weight of 337.28 g/mol. Its IUPAC name is 2-[2-(1,2-dicarboxyethoxy)ethyl-(2-hydroxyethyl)amino]butanedioic acid.
| Compound Name | 2-[2-(1,2-dicarboxyethoxy)ethyl-(2-hydroxyethyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 59356945 |
| Molecular Formula | C12H19NO10 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-[2-(1,2-dicarboxyethoxy)ethyl-(2-hydroxyethyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(OCCN(CCO)C(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H19NO10/c14-3-1-13(7(11(19)20)5-9(15)16)2-4-23-8(12(21)22)6-10(17)18/h7-8,14H,1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | SYGQUSOLFMZUQS-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 181.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |