About 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol
2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol (PubChem CID 87565763) has the molecular formula C20H40O9
and a molecular weight of 424.53 g/mol. Its IUPAC name is 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol.
Molecular Properties
| Compound Name | 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol |
| PubChem CID | 87565763 |
| Molecular Formula | C20H40O9 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol |
| SMILES | CCCCOC(CC(=O)O)C(=O)O.OCCCCOCCCCOCCCCO |
| InChI | InChI=1S/C12H26O4.C8H14O5/c13-7-1-3-9-15-11-5-6-12-16-10-4-2-8-14;1-2-3-4-13-6(8(11)12)5-7(9)10/h13-14H,1-12H2;6H,2-5H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | GXXJXYXXDXRJRI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol?
The IUPAC name of 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol (CID 87565763) is 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol.
What is the SMILES notation for 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol?
The canonical SMILES for 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol is CCCCOC(CC(=O)O)C(=O)O.OCCCCOCCCCOCCCCO.
What is the InChIKey of 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol?
The InChIKey is GXXJXYXXDXRJRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O4.C8H14O5/c13-7-1-3-9-15-11-5-6-12-16-10-4-2-8-14;1-2-3-4-13-6(8(11)12)5-7(9)10/h13-14H,1-12H2;6H,2-5H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol?
2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol has a molecular weight of 424.53 g/mol, XLogP of 2.08, 20 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxybutanedioic acid;4-[4-(4-hydroxybutoxy)butoxy]butan-1-ol is sourced from PubChem (CID 87565763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).