C14H28O9 — CID 87566877
2-butoxybutanedioic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol (PubChem CID 87566877) has the molecular formula C14H28O9 and a molecular weight of 340.37 g/mol. Its IUPAC name is 2-butoxybutanedioic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol.
| Compound Name | 2-butoxybutanedioic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 87566877 |
| Molecular Formula | C14H28O9 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-butoxybutanedioic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
| SMILES | CCCCOC(CC(=O)O)C(=O)O.OCCOCCOCCO |
| InChI | InChI=1S/C8H14O5.C6H14O4/c1-2-3-4-13-6(8(11)12)5-7(9)10;7-1-3-9-5-6-10-4-2-8/h6H,2-5H2,1H3,(H,9,10)(H,11,12);7-8H,1-6H2 |
| InChIKey | BQKHWIUDTDDICT-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|