About 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol
2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol (PubChem CID 87566742) has the molecular formula C15H32O6
and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol.
Molecular Properties
| Compound Name | 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol |
| PubChem CID | 87566742 |
| Molecular Formula | C15H32O6 |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol |
| SMILES | CCCCOC(C)C(=O)O.OCCCCOCCCCO |
| InChI | InChI=1S/C8H18O3.C7H14O3/c9-5-1-3-7-11-8-4-2-6-10;1-3-4-5-10-6(2)7(8)9/h9-10H,1-8H2;6H,3-5H2,1-2H3,(H,8,9) |
| InChIKey | XPOWUJOGBXIKKS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol?
The IUPAC name of 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol (CID 87566742) is 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol.
What is the SMILES notation for 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol?
The canonical SMILES for 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol is CCCCOC(C)C(=O)O.OCCCCOCCCCO.
What is the InChIKey of 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol?
The InChIKey is XPOWUJOGBXIKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3.C7H14O3/c9-5-1-3-7-11-8-4-2-6-10;1-3-4-5-10-6(2)7(8)9/h9-10H,1-8H2;6H,3-5H2,1-2H3,(H,8,9).
What are the key properties of 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol?
2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol has a molecular weight of 308.41 g/mol, XLogP of 1.82, 13 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxypropanoic acid;4-(4-hydroxybutoxy)butan-1-ol is sourced from PubChem (CID 87566742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).