C12H19NO10 — CID 137372270
2-[2-[2-(carboxymethoxy)ethyl-(carboxymethyl)amino]ethoxy]butanedioic acid (PubChem CID 137372270) has the molecular formula C12H19NO10 and a molecular weight of 337.28 g/mol. Its IUPAC name is 2-[2-[2-(carboxymethoxy)ethyl-(carboxymethyl)amino]ethoxy]butanedioic acid.
| Compound Name | 2-[2-[2-(carboxymethoxy)ethyl-(carboxymethyl)amino]ethoxy]butanedioic acid |
|---|---|
| PubChem CID | 137372270 |
| Molecular Formula | C12H19NO10 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-[2-[2-(carboxymethoxy)ethyl-(carboxymethyl)amino]ethoxy]butanedioic acid |
| SMILES | O=C(O)COCCN(CCOC(CC(=O)O)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C12H19NO10/c14-9(15)5-8(12(20)21)23-4-2-13(6-10(16)17)1-3-22-7-11(18)19/h8H,1-7H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | YAOCJZHDGYAFFV-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 170.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|