C9H19NO4 — CID 122500414
2-[2-hydroxyethyl(2-propan-2-yloxyethyl)amino]acetic acid (PubChem CID 122500414) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2-propan-2-yloxyethyl)amino]acetic acid.
| Compound Name | 2-[2-hydroxyethyl(2-propan-2-yloxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 122500414 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-[2-hydroxyethyl(2-propan-2-yloxyethyl)amino]acetic acid |
| SMILES | CC(C)OCCN(CCO)CC(=O)O |
| InChI | InChI=1S/C9H19NO4/c1-8(2)14-6-4-10(3-5-11)7-9(12)13/h8,11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | KJNMCPLENQVHKV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |