C10H19NO4 — CID 161235975
2-[2-hydroxyprop-2-enyl(2-propan-2-yloxyethyl)amino]acetic acid (PubChem CID 161235975) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-[2-hydroxyprop-2-enyl(2-propan-2-yloxyethyl)amino]acetic acid.
| Compound Name | 2-[2-hydroxyprop-2-enyl(2-propan-2-yloxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 161235975 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-[2-hydroxyprop-2-enyl(2-propan-2-yloxyethyl)amino]acetic acid |
| SMILES | C=C(O)CN(CCOC(C)C)CC(=O)O |
| InChI | InChI=1S/C10H19NO4/c1-8(2)15-5-4-11(6-9(3)12)7-10(13)14/h8,12H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | KDJJCDFPUFQCPL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|