C12H21NO8 — CID 90459132
2-[2-[2-(1-carboxyethoxy)ethyl-(carboxymethyl)amino]ethoxy]propanoic acid (PubChem CID 90459132) has the molecular formula C12H21NO8 and a molecular weight of 307.30 g/mol. Its IUPAC name is 2-[2-[2-(1-carboxyethoxy)ethyl-(carboxymethyl)amino]ethoxy]propanoic acid.
| Compound Name | 2-[2-[2-(1-carboxyethoxy)ethyl-(carboxymethyl)amino]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 90459132 |
| Molecular Formula | C12H21NO8 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-[2-[2-(1-carboxyethoxy)ethyl-(carboxymethyl)amino]ethoxy]propanoic acid |
| SMILES | CC(OCCN(CCOC(C)C(=O)O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21NO8/c1-8(11(16)17)20-5-3-13(7-10(14)15)4-6-21-9(2)12(18)19/h8-9H,3-7H2,1-2H3,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | BDWWGINOMUCHRU-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |