ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid

C10H23NO3 — CID 156795596

IUPACethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid
SMILESCC.CC(C)OCCN(C)CC(=O)O
InChIInChI=1S/C8H17NO3.C2H6/c1-7(2)12-5-4-9(3)6-8(10)11;1-2/h7H,4-6H2,1-3H3,(H,10,11);1-2H3
InChIKeyUIPQBBWEUYLXSN-UHFFFAOYSA-N
MW205.30 g/mol
LogP1.45
Rot. Bonds6

About ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid

ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid (PubChem CID 156795596) has the molecular formula C10H23NO3 and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid.

Molecular Properties

Compound Nameethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid
PubChem CID156795596
Molecular FormulaC10H23NO3
Molecular Weight205.30 g/mol
Exact Mass205.17
IUPAC Nameethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid
SMILESCC.CC(C)OCCN(C)CC(=O)O
InChIInChI=1S/C8H17NO3.C2H6/c1-7(2)12-5-4-9(3)6-8(10)11;1-2/h7H,4-6H2,1-3H3,(H,10,11);1-2H3
InChIKeyUIPQBBWEUYLXSN-UHFFFAOYSA-N
XLogP1.45
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.30
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid?
The IUPAC name of ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid (CID 156795596) is ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid.
What is the SMILES notation for ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid?
The canonical SMILES for ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid is CC.CC(C)OCCN(C)CC(=O)O.
What is the InChIKey of ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid?
The InChIKey is UIPQBBWEUYLXSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3.C2H6/c1-7(2)12-5-4-9(3)6-8(10)11;1-2/h7H,4-6H2,1-3H3,(H,10,11);1-2H3.
What are the key properties of ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid?
ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid has a molecular weight of 205.30 g/mol, XLogP of 1.45, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid is sourced from PubChem (CID 156795596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).