C10H23NO3 — CID 156795596
ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid (PubChem CID 156795596) has the molecular formula C10H23NO3 and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid.
| Compound Name | ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 156795596 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | ethane;2-[methyl(2-propan-2-yloxyethyl)amino]acetic acid |
| SMILES | CC.CC(C)OCCN(C)CC(=O)O |
| InChI | InChI=1S/C8H17NO3.C2H6/c1-7(2)12-5-4-9(3)6-8(10)11;1-2/h7H,4-6H2,1-3H3,(H,10,11);1-2H3 |
| InChIKey | UIPQBBWEUYLXSN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |