C16H23NO14 — CID 10994081
2-[bis[2-(1,2-dicarboxyethoxy)ethyl]amino]butanedioic acid (PubChem CID 10994081) has the molecular formula C16H23NO14 and a molecular weight of 453.35 g/mol. Its IUPAC name is 2-[bis[2-(1,2-dicarboxyethoxy)ethyl]amino]butanedioic acid.
| Compound Name | 2-[bis[2-(1,2-dicarboxyethoxy)ethyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 10994081 |
| Molecular Formula | C16H23NO14 |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[bis[2-(1,2-dicarboxyethoxy)ethyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(OCCN(CCOC(CC(=O)O)C(=O)O)C(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H23NO14/c18-11(19)5-8(14(24)25)17(1-3-30-9(15(26)27)6-12(20)21)2-4-31-10(16(28)29)7-13(22)23/h8-10H,1-7H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | NKIMVYCHUBDCSC-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 245.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |