C12H21NO10 — CID 21134481
2-[2-[2-(1-carboxy-3-hydroperoxypropoxy)ethylamino]ethoxy]butanedioic acid (PubChem CID 21134481) has the molecular formula C12H21NO10 and a molecular weight of 339.30 g/mol. Its IUPAC name is 2-[2-[2-(1-carboxy-3-hydroperoxypropoxy)ethylamino]ethoxy]butanedioic acid.
| Compound Name | 2-[2-[2-(1-carboxy-3-hydroperoxypropoxy)ethylamino]ethoxy]butanedioic acid |
|---|---|
| PubChem CID | 21134481 |
| Molecular Formula | C12H21NO10 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[2-[2-(1-carboxy-3-hydroperoxypropoxy)ethylamino]ethoxy]butanedioic acid |
| SMILES | O=C(O)CC(OCCNCCOC(CCOO)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21NO10/c14-10(15)7-9(12(18)19)22-6-3-13-2-5-21-8(11(16)17)1-4-23-20/h8-9,13,20H,1-7H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | NNZPUCSFIFVXQZ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|