C6H11Na3O7 — CID 173014091
trisodium;2-(carboxymethoxy)butanedioic acid;hydride (PubChem CID 173014091) has the molecular formula C6H11Na3O7 and a molecular weight of 264.12 g/mol. Its IUPAC name is trisodium;2-(carboxymethoxy)butanedioic acid;hydride.
| Compound Name | trisodium;2-(carboxymethoxy)butanedioic acid;hydride |
|---|---|
| PubChem CID | 173014091 |
| Molecular Formula | C6H11Na3O7 |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | trisodium;2-(carboxymethoxy)butanedioic acid;hydride |
| SMILES | O=C(O)COC(CC(=O)O)C(=O)O.[H-].[H-].[H-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H8O7.3Na.3H/c7-4(8)1-3(6(11)12)13-2-5(9)10;;;;;;/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;;;;/q;3*+1;3*-1 |
| InChIKey | GVQIFSHKAHIFIS-UHFFFAOYSA-N |
| XLogP | -9.64 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | -9.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |