C12H15NO12 — CID 87974974
2-[bis(1,2-dicarboxyethyl)amino]butanedioic acid (PubChem CID 87974974) has the molecular formula C12H15NO12 and a molecular weight of 365.25 g/mol. Its IUPAC name is 2-[bis(1,2-dicarboxyethyl)amino]butanedioic acid.
| Compound Name | 2-[bis(1,2-dicarboxyethyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 87974974 |
| Molecular Formula | C12H15NO12 |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-[bis(1,2-dicarboxyethyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)N(C(CC(=O)O)C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H15NO12/c14-7(15)1-4(10(20)21)13(5(11(22)23)2-8(16)17)6(12(24)25)3-9(18)19/h4-6H,1-3H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | WTHDRQNRUURKAF-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 227.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |