C12H19N3O10 — CID 57295439
2-[[2-aminoethyl(carboxymethyl)amino]-(1,2-dicarboxyethyl)amino]butanedioic acid (PubChem CID 57295439) has the molecular formula C12H19N3O10 and a molecular weight of 365.30 g/mol. Its IUPAC name is 2-[[2-aminoethyl(carboxymethyl)amino]-(1,2-dicarboxyethyl)amino]butanedioic acid.
| Compound Name | 2-[[2-aminoethyl(carboxymethyl)amino]-(1,2-dicarboxyethyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 57295439 |
| Molecular Formula | C12H19N3O10 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[[2-aminoethyl(carboxymethyl)amino]-(1,2-dicarboxyethyl)amino]butanedioic acid |
| SMILES | NCCN(CC(=O)O)N(C(CC(=O)O)C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H19N3O10/c13-1-2-14(5-10(20)21)15(6(11(22)23)3-8(16)17)7(12(24)25)4-9(18)19/h6-7H,1-5,13H2,(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | NLZLZBPTOLGAMX-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 219.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|