C14H23N3O10 — CID 173131186
2-[2-[2-[bis(carboxymethyl)amino]ethylamino]ethyl-(carboxymethyl)amino]butanedioic acid (PubChem CID 173131186) has the molecular formula C14H23N3O10 and a molecular weight of 393.35 g/mol. Its IUPAC name is 2-[2-[2-[bis(carboxymethyl)amino]ethylamino]ethyl-(carboxymethyl)amino]butanedioic acid.
| Compound Name | 2-[2-[2-[bis(carboxymethyl)amino]ethylamino]ethyl-(carboxymethyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 173131186 |
| Molecular Formula | C14H23N3O10 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-[2-[2-[bis(carboxymethyl)amino]ethylamino]ethyl-(carboxymethyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)N(CCNCCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H23N3O10/c18-10(19)5-9(14(26)27)17(8-13(24)25)4-2-15-1-3-16(6-11(20)21)7-12(22)23/h9,15H,1-8H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | JFACQUKDWQOSNW-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 205.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|