C14H25N3O8 — CID 90249102
(2S)-6-amino-2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]hexanoic acid (PubChem CID 90249102) has the molecular formula C14H25N3O8 and a molecular weight of 363.37 g/mol. Its IUPAC name is (2S)-6-amino-2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 90249102 |
| Molecular Formula | C14H25N3O8 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (2S)-6-amino-2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]hexanoic acid |
| SMILES | NCCCC[C@@H](C(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H25N3O8/c15-4-2-1-3-10(14(24)25)17(9-13(22)23)6-5-16(7-11(18)19)8-12(20)21/h10H,1-9,15H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)/t10-/m0/s1 |
| InChIKey | TWCOOJLVCGTLKX-JTQLQIEISA-N |
| XLogP | -1.57 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|