C7H18N2O8P2 — CID 87461792
(2R)-5-amino-2-[bis(phosphonomethyl)amino]pentanoic acid (PubChem CID 87461792) has the molecular formula C7H18N2O8P2 and a molecular weight of 320.18 g/mol. Its IUPAC name is (2R)-5-amino-2-[bis(phosphonomethyl)amino]pentanoic acid.
| Compound Name | (2R)-5-amino-2-[bis(phosphonomethyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 87461792 |
| Molecular Formula | C7H18N2O8P2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (2R)-5-amino-2-[bis(phosphonomethyl)amino]pentanoic acid |
| SMILES | NCCC[C@H](C(=O)O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C7H18N2O8P2/c8-3-1-2-6(7(10)11)9(4-18(12,13)14)5-19(15,16)17/h6H,1-5,8H2,(H,10,11)(H2,12,13,14)(H2,15,16,17)/t6-/m1/s1 |
| InChIKey | YAOPOJSYQOUVIC-ZCFIWIBFSA-N |
| XLogP | -1.25 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|