C6H15N2O6P — CID 54536172
(2S)-6-amino-2-[hydroxy(phosphono)amino]hexanoic acid (PubChem CID 54536172) has the molecular formula C6H15N2O6P and a molecular weight of 242.17 g/mol. Its IUPAC name is (2S)-6-amino-2-[hydroxy(phosphono)amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[hydroxy(phosphono)amino]hexanoic acid |
|---|---|
| PubChem CID | 54536172 |
| Molecular Formula | C6H15N2O6P |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (2S)-6-amino-2-[hydroxy(phosphono)amino]hexanoic acid |
| SMILES | NCCCC[C@@H](C(=O)O)N(O)P(=O)(O)O |
| InChI | InChI=1S/C6H15N2O6P/c7-4-2-1-3-5(6(9)10)8(11)15(12,13)14/h5,11H,1-4,7H2,(H,9,10)(H2,12,13,14)/t5-/m0/s1 |
| InChIKey | YZXQYDKRDFJEHB-YFKPBYRVSA-N |
| XLogP | -0.65 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|