C7H17N2O6P — CID 25153752
(2S)-6-amino-2-[hydroxy(phosphonomethyl)amino]hexanoic acid (PubChem CID 25153752) has the molecular formula C7H17N2O6P and a molecular weight of 256.19 g/mol. Its IUPAC name is (2S)-6-amino-2-[hydroxy(phosphonomethyl)amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[hydroxy(phosphonomethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 25153752 |
| Molecular Formula | C7H17N2O6P |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (2S)-6-amino-2-[hydroxy(phosphonomethyl)amino]hexanoic acid |
| SMILES | NCCCC[C@@H](C(=O)O)N(O)CP(=O)(O)O |
| InChI | InChI=1S/C7H17N2O6P/c8-4-2-1-3-6(7(10)11)9(12)5-16(13,14)15/h6,12H,1-5,8H2,(H,10,11)(H2,13,14,15)/t6-/m0/s1 |
| InChIKey | RMOSJJJYITULTD-LURJTMIESA-N |
| XLogP | -0.61 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|