C14H28N2O8P2 — CID 87492563
6-amino-2-[bis(2-phosphonobut-3-enyl)amino]hexanoic acid (PubChem CID 87492563) has the molecular formula C14H28N2O8P2 and a molecular weight of 414.33 g/mol. Its IUPAC name is 6-amino-2-[bis(2-phosphonobut-3-enyl)amino]hexanoic acid.
| Compound Name | 6-amino-2-[bis(2-phosphonobut-3-enyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 87492563 |
| Molecular Formula | C14H28N2O8P2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 6-amino-2-[bis(2-phosphonobut-3-enyl)amino]hexanoic acid |
| SMILES | C=CC(CN(CC(C=C)P(=O)(O)O)C(CCCCN)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C14H28N2O8P2/c1-3-11(25(19,20)21)9-16(10-12(4-2)26(22,23)24)13(14(17)18)7-5-6-8-15/h3-4,11-13H,1-2,5-10,15H2,(H,17,18)(H2,19,20,21)(H2,22,23,24) |
| InChIKey | VMDXTCFYHMRJAK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|